N-(2-ethylphenyl)-3-[5-(4-fluorophenyl)furan-2-yl]propanamide
Chemical Structure Depiction of
N-(2-ethylphenyl)-3-[5-(4-fluorophenyl)furan-2-yl]propanamide
N-(2-ethylphenyl)-3-[5-(4-fluorophenyl)furan-2-yl]propanamide
Compound characteristics
| Compound ID: | J048-0005 |
| Compound Name: | N-(2-ethylphenyl)-3-[5-(4-fluorophenyl)furan-2-yl]propanamide |
| Molecular Weight: | 337.39 |
| Molecular Formula: | C21 H20 F N O2 |
| Smiles: | CCc1ccccc1NC(CCc1ccc(c2ccc(cc2)F)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8753 |
| logD: | 4.8753 |
| logSw: | -4.4883 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 29.9882 |
| InChI Key: | PUPRWSQKIYRZNC-UHFFFAOYSA-N |