N-(2-fluorophenyl)-3-[5-(4-methylphenyl)furan-2-yl]propanamide
Chemical Structure Depiction of
N-(2-fluorophenyl)-3-[5-(4-methylphenyl)furan-2-yl]propanamide
N-(2-fluorophenyl)-3-[5-(4-methylphenyl)furan-2-yl]propanamide
Compound characteristics
| Compound ID: | J048-0030 |
| Compound Name: | N-(2-fluorophenyl)-3-[5-(4-methylphenyl)furan-2-yl]propanamide |
| Molecular Weight: | 323.37 |
| Molecular Formula: | C20 H18 F N O2 |
| Smiles: | Cc1ccc(cc1)c1ccc(CCC(Nc2ccccc2F)=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 4.5502 |
| logD: | 4.5497 |
| logSw: | -4.3065 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 29.9882 |
| InChI Key: | FVCAQJHPSUFPRA-UHFFFAOYSA-N |