3-[5-(4-chlorophenyl)furan-2-yl]-N-(3-methoxyphenyl)propanamide
Chemical Structure Depiction of
3-[5-(4-chlorophenyl)furan-2-yl]-N-(3-methoxyphenyl)propanamide
3-[5-(4-chlorophenyl)furan-2-yl]-N-(3-methoxyphenyl)propanamide
Compound characteristics
| Compound ID: | J048-0072 |
| Compound Name: | 3-[5-(4-chlorophenyl)furan-2-yl]-N-(3-methoxyphenyl)propanamide |
| Molecular Weight: | 355.82 |
| Molecular Formula: | C20 H18 Cl N O3 |
| Smiles: | COc1cccc(c1)NC(CCc1ccc(c2ccc(cc2)[Cl])o1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0078 |
| logD: | 5.0078 |
| logSw: | -5.2335 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.23 |
| InChI Key: | BTYQMELVOAQNKM-UHFFFAOYSA-N |