3-({5-[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-2-methylbenzene-1-sulfonyl}amino)benzoic acid
Chemical Structure Depiction of
3-({5-[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-2-methylbenzene-1-sulfonyl}amino)benzoic acid
3-({5-[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-2-methylbenzene-1-sulfonyl}amino)benzoic acid
Compound characteristics
| Compound ID: | J057-1189 |
| Compound Name: | 3-({5-[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-2-methylbenzene-1-sulfonyl}amino)benzoic acid |
| Molecular Weight: | 495.51 |
| Molecular Formula: | C24 H21 N3 O7 S |
| Smiles: | Cc1ccc(cc1S(Nc1cccc(c1)C(O)=O)(=O)=O)c1nnc(c2ccc(c(c2)OC)OC)o1 |
| Stereo: | ACHIRAL |
| logP: | 4.3204 |
| logD: | 1.5703 |
| logSw: | -4.2751 |
| Hydrogen bond acceptors count: | 12 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 114.801 |
| InChI Key: | AOXKEQBSXYIHNT-UHFFFAOYSA-N |