N-(4-fluorophenyl)-1-{[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl}piperidine-4-carboxamide
Chemical Structure Depiction of
N-(4-fluorophenyl)-1-{[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl}piperidine-4-carboxamide
N-(4-fluorophenyl)-1-{[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl}piperidine-4-carboxamide
Compound characteristics
| Compound ID: | J065-0235 |
| Compound Name: | N-(4-fluorophenyl)-1-{[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl}piperidine-4-carboxamide |
| Molecular Weight: | 398.41 |
| Molecular Formula: | C21 H20 F2 N4 O2 |
| Smiles: | C1CN(CCC1C(Nc1ccc(cc1)F)=O)Cc1nc(c2ccc(cc2)F)on1 |
| Stereo: | ACHIRAL |
| logP: | 3.1391 |
| logD: | 3.1236 |
| logSw: | -3.2575 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.73 |
| InChI Key: | KQLQSECIRMAJTP-UHFFFAOYSA-N |