N-{[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl}-2-(3-methylphenyl)acetamide
Chemical Structure Depiction of
N-{[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl}-2-(3-methylphenyl)acetamide
N-{[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl}-2-(3-methylphenyl)acetamide
Compound characteristics
| Compound ID: | J075-0639 |
| Compound Name: | N-{[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl}-2-(3-methylphenyl)acetamide |
| Molecular Weight: | 325.34 |
| Molecular Formula: | C18 H16 F N3 O2 |
| Smiles: | Cc1cccc(CC(NCc2nc(c3ccc(cc3)F)on2)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 3.5783 |
| logD: | 3.5783 |
| logSw: | -3.7301 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.106 |
| InChI Key: | JLRJHWCXOMXACY-UHFFFAOYSA-N |