1-benzyl-3-{4-[4-(2-fluorophenyl)piperazine-1-carbonyl]phenyl}-1,3-diazinan-2-one
Chemical Structure Depiction of
1-benzyl-3-{4-[4-(2-fluorophenyl)piperazine-1-carbonyl]phenyl}-1,3-diazinan-2-one
1-benzyl-3-{4-[4-(2-fluorophenyl)piperazine-1-carbonyl]phenyl}-1,3-diazinan-2-one
Compound characteristics
| Compound ID: | J076-0734 |
| Compound Name: | 1-benzyl-3-{4-[4-(2-fluorophenyl)piperazine-1-carbonyl]phenyl}-1,3-diazinan-2-one |
| Molecular Weight: | 472.56 |
| Molecular Formula: | C28 H29 F N4 O2 |
| Smiles: | C1CN(Cc2ccccc2)C(N(C1)c1ccc(cc1)C(N1CCN(CC1)c1ccccc1F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1429 |
| logD: | 4.1429 |
| logSw: | -4.2104 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 39.405 |
| InChI Key: | MLCGYJDQXBDMLO-UHFFFAOYSA-N |