2-{4-[(6-ethoxy-2-oxo-2H-1-benzopyran-4-yl)methyl]piperazin-1-yl}-N-(2,4,6-trimethylphenyl)acetamide
Chemical Structure Depiction of
2-{4-[(6-ethoxy-2-oxo-2H-1-benzopyran-4-yl)methyl]piperazin-1-yl}-N-(2,4,6-trimethylphenyl)acetamide
2-{4-[(6-ethoxy-2-oxo-2H-1-benzopyran-4-yl)methyl]piperazin-1-yl}-N-(2,4,6-trimethylphenyl)acetamide
Compound characteristics
| Compound ID: | J079-0612 |
| Compound Name: | 2-{4-[(6-ethoxy-2-oxo-2H-1-benzopyran-4-yl)methyl]piperazin-1-yl}-N-(2,4,6-trimethylphenyl)acetamide |
| Molecular Weight: | 463.58 |
| Molecular Formula: | C27 H33 N3 O4 |
| Smiles: | CCOc1ccc2c(c1)C(CN1CCN(CC1)CC(Nc1c(C)cc(C)cc1C)=O)=CC(=O)O2 |
| Stereo: | ACHIRAL |
| logP: | 3.6005 |
| logD: | 3.5631 |
| logSw: | -3.6581 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.796 |
| InChI Key: | PQGNEHBCBPVMNZ-UHFFFAOYSA-N |