6-ethyl-4-[(piperidin-1-yl)methyl]-2H-1-benzopyran-2-one
Chemical Structure Depiction of
6-ethyl-4-[(piperidin-1-yl)methyl]-2H-1-benzopyran-2-one
6-ethyl-4-[(piperidin-1-yl)methyl]-2H-1-benzopyran-2-one
Compound characteristics
| Compound ID: | J079-0711 |
| Compound Name: | 6-ethyl-4-[(piperidin-1-yl)methyl]-2H-1-benzopyran-2-one |
| Molecular Weight: | 271.36 |
| Molecular Formula: | C17 H21 N O2 |
| Smiles: | CCc1ccc2c(c1)C(CN1CCCCC1)=CC(=O)O2 |
| Stereo: | ACHIRAL |
| logP: | 3.1665 |
| logD: | 1.8975 |
| logSw: | -3.3698 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 24.3783 |
| InChI Key: | SRSQPUKOLPPFOO-UHFFFAOYSA-N |