6-(5-ethylthiophen-2-yl)-5-(4-methoxyphenyl)-1-methyl-1H-pyrrolo[2,3-d]pyrimidine-2,4(3H,7H)-dione
Chemical Structure Depiction of
6-(5-ethylthiophen-2-yl)-5-(4-methoxyphenyl)-1-methyl-1H-pyrrolo[2,3-d]pyrimidine-2,4(3H,7H)-dione
6-(5-ethylthiophen-2-yl)-5-(4-methoxyphenyl)-1-methyl-1H-pyrrolo[2,3-d]pyrimidine-2,4(3H,7H)-dione
Compound characteristics
| Compound ID: | J080-0445 |
| Compound Name: | 6-(5-ethylthiophen-2-yl)-5-(4-methoxyphenyl)-1-methyl-1H-pyrrolo[2,3-d]pyrimidine-2,4(3H,7H)-dione |
| Molecular Weight: | 381.45 |
| Molecular Formula: | C20 H19 N3 O3 S |
| Smiles: | CCc1ccc(c2c(c3ccc(cc3)OC)c3C(NC(N(C)c3[nH]2)=O)=O)s1 |
| Stereo: | ACHIRAL |
| logP: | 4.5533 |
| logD: | 4.5533 |
| logSw: | -4.536 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.962 |
| InChI Key: | IKNQUBGBMCJELL-UHFFFAOYSA-N |