3-{2-[5-(4-chlorophenyl)furan-2-yl]-2-oxoethyl}-5-fluoro-3-hydroxy-1,3-dihydro-2H-indol-2-one
Chemical Structure Depiction of
3-{2-[5-(4-chlorophenyl)furan-2-yl]-2-oxoethyl}-5-fluoro-3-hydroxy-1,3-dihydro-2H-indol-2-one
3-{2-[5-(4-chlorophenyl)furan-2-yl]-2-oxoethyl}-5-fluoro-3-hydroxy-1,3-dihydro-2H-indol-2-one
Compound characteristics
| Compound ID: | J092-0003 |
| Compound Name: | 3-{2-[5-(4-chlorophenyl)furan-2-yl]-2-oxoethyl}-5-fluoro-3-hydroxy-1,3-dihydro-2H-indol-2-one |
| Molecular Weight: | 385.78 |
| Molecular Formula: | C20 H13 Cl F N O4 |
| Smiles: | C(C(c1ccc(c2ccc(cc2)[Cl])o1)=O)C1(C(Nc2ccc(cc12)F)=O)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.0017 |
| logD: | 4.0002 |
| logSw: | -4.4426 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 62.217 |
| InChI Key: | XEMFHWFXWLFASG-FQEVSTJZSA-N |