N-(5-chloro-2-methylphenyl)-5-(4-fluorophenyl)-7-(trifluoromethyl)[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide
Chemical Structure Depiction of
N-(5-chloro-2-methylphenyl)-5-(4-fluorophenyl)-7-(trifluoromethyl)[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide
N-(5-chloro-2-methylphenyl)-5-(4-fluorophenyl)-7-(trifluoromethyl)[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide
Compound characteristics
| Compound ID: | J093-0024 |
| Compound Name: | N-(5-chloro-2-methylphenyl)-5-(4-fluorophenyl)-7-(trifluoromethyl)[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| Molecular Weight: | 449.79 |
| Molecular Formula: | C20 H12 Cl F4 N5 O |
| Smiles: | Cc1ccc(cc1NC(c1nc2nc(cc(C(F)(F)F)n2n1)c1ccc(cc1)F)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.0974 |
| logD: | 5.0959 |
| logSw: | -5.4696 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.174 |
| InChI Key: | NTOJPRIUTIQETC-UHFFFAOYSA-N |