N-(4-chloro-2-methylphenyl)-5-(furan-2-yl)-7-(trifluoromethyl)[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide
Chemical Structure Depiction of
N-(4-chloro-2-methylphenyl)-5-(furan-2-yl)-7-(trifluoromethyl)[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide
N-(4-chloro-2-methylphenyl)-5-(furan-2-yl)-7-(trifluoromethyl)[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide
Compound characteristics
| Compound ID: | J093-0640 |
| Compound Name: | N-(4-chloro-2-methylphenyl)-5-(furan-2-yl)-7-(trifluoromethyl)[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| Molecular Weight: | 421.76 |
| Molecular Formula: | C18 H11 Cl F3 N5 O2 |
| Smiles: | Cc1cc(ccc1NC(c1nc2nc(cc(C(F)(F)F)n2n1)c1ccco1)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.3782 |
| logD: | 4.3769 |
| logSw: | -4.5464 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.753 |
| InChI Key: | NTDASNQWLYXYDX-UHFFFAOYSA-N |