2-methyl-6-oxo-N-[4-(propan-2-yl)phenyl]-1,2-dihydro-6H-pyrrolo[3,2,1-ij]quinoline-5-carboxamide
Chemical Structure Depiction of
2-methyl-6-oxo-N-[4-(propan-2-yl)phenyl]-1,2-dihydro-6H-pyrrolo[3,2,1-ij]quinoline-5-carboxamide
2-methyl-6-oxo-N-[4-(propan-2-yl)phenyl]-1,2-dihydro-6H-pyrrolo[3,2,1-ij]quinoline-5-carboxamide
Compound characteristics
| Compound ID: | J099-0131 |
| Compound Name: | 2-methyl-6-oxo-N-[4-(propan-2-yl)phenyl]-1,2-dihydro-6H-pyrrolo[3,2,1-ij]quinoline-5-carboxamide |
| Molecular Weight: | 346.43 |
| Molecular Formula: | C22 H22 N2 O2 |
| Smiles: | CC(C)c1ccc(cc1)NC(C1=CN2C(C)Cc3cccc(C1=O)c23)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7417 |
| logD: | 4.7411 |
| logSw: | -4.5739 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.981 |
| InChI Key: | KVIMPGXSKHMNKW-CQSZACIVSA-N |