2-(furan-2-yl)-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine
Chemical Structure Depiction of
2-(furan-2-yl)-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine
2-(furan-2-yl)-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine
Compound characteristics
| Compound ID: | J108-0406 |
| Compound Name: | 2-(furan-2-yl)-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine |
| Molecular Weight: | 352.35 |
| Molecular Formula: | C18 H16 N4 O4 |
| Smiles: | COc1cc(cc(c1OC)OC)c1ccnc2nc(c3ccco3)nn12 |
| Stereo: | ACHIRAL |
| logP: | 2.2792 |
| logD: | 2.2792 |
| logSw: | -2.5433 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 61.498 |
| InChI Key: | DMYAKVFJQVHLQJ-UHFFFAOYSA-N |