2-cyclobutyl-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine
Chemical Structure Depiction of
2-cyclobutyl-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine
2-cyclobutyl-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine
Compound characteristics
| Compound ID: | J108-0414 |
| Compound Name: | 2-cyclobutyl-7-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine |
| Molecular Weight: | 340.38 |
| Molecular Formula: | C18 H20 N4 O3 |
| Smiles: | COc1cc(cc(c1OC)OC)c1ccnc2nc(C3CCC3)nn12 |
| Stereo: | ACHIRAL |
| logP: | 2.2325 |
| logD: | 2.2325 |
| logSw: | -2.5036 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 53.443 |
| InChI Key: | YUPORNZTNBDQAK-UHFFFAOYSA-N |