N'-(5-fluoro-2-oxo-1,2-dihydro-3H-indol-3-ylidene)benzohydrazide
Chemical Structure Depiction of
N'-(5-fluoro-2-oxo-1,2-dihydro-3H-indol-3-ylidene)benzohydrazide
N'-(5-fluoro-2-oxo-1,2-dihydro-3H-indol-3-ylidene)benzohydrazide
Compound characteristics
| Compound ID: | K017-0041 |
| Compound Name: | N'-(5-fluoro-2-oxo-1,2-dihydro-3H-indol-3-ylidene)benzohydrazide |
| Molecular Weight: | 283.26 |
| Molecular Formula: | C15 H10 F N3 O2 |
| Smiles: | c1ccc(cc1)C(N/N=C1C(Nc2ccc(cc\12)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5583 |
| logD: | 1.9341 |
| logSw: | -3.491 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.364 |
| InChI Key: | HYCCYZPTLPQYOH-UHFFFAOYSA-N |