3-[2-(4-tert-butylphenyl)hydrazinylidene]-1,3-dihydro-2H-indol-2-one
Chemical Structure Depiction of
3-[2-(4-tert-butylphenyl)hydrazinylidene]-1,3-dihydro-2H-indol-2-one
3-[2-(4-tert-butylphenyl)hydrazinylidene]-1,3-dihydro-2H-indol-2-one
Compound characteristics
| Compound ID: | K017-0073 |
| Compound Name: | 3-[2-(4-tert-butylphenyl)hydrazinylidene]-1,3-dihydro-2H-indol-2-one |
| Molecular Weight: | 293.37 |
| Molecular Formula: | C18 H19 N3 O |
| Smiles: | CC(C)(C)c1ccc(cc1)N/N=C1C(Nc2ccccc\12)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9258 |
| logD: | 4.9258 |
| logSw: | -4.5073 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 45.185 |
| InChI Key: | XAOBWSZZOQPTSV-UHFFFAOYSA-N |