N-[2-(3,4-dimethoxyphenyl)ethyl]-8-ethoxy-2-[2-(3-fluorobenzoyl)hydrazinylidene]-2H-1-benzopyran-3-carboxamide
Chemical Structure Depiction of
N-[2-(3,4-dimethoxyphenyl)ethyl]-8-ethoxy-2-[2-(3-fluorobenzoyl)hydrazinylidene]-2H-1-benzopyran-3-carboxamide
N-[2-(3,4-dimethoxyphenyl)ethyl]-8-ethoxy-2-[2-(3-fluorobenzoyl)hydrazinylidene]-2H-1-benzopyran-3-carboxamide
Compound characteristics
| Compound ID: | K024-0085 |
| Compound Name: | N-[2-(3,4-dimethoxyphenyl)ethyl]-8-ethoxy-2-[2-(3-fluorobenzoyl)hydrazinylidene]-2H-1-benzopyran-3-carboxamide |
| Molecular Weight: | 533.56 |
| Molecular Formula: | C29 H28 F N3 O6 |
| Smiles: | CCOc1cccc2C=C(/C(=N/NC(c3cccc(c3)F)=O)Oc12)C(NCCc1ccc(c(c1)OC)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6399 |
| logD: | 3.5274 |
| logSw: | -4.1059 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 89.502 |
| InChI Key: | BQYILHWLDXOFBZ-UHFFFAOYSA-N |