1-{[(2,4-dichlorophenyl)methylidene]amino}-4-(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-amine
Chemical Structure Depiction of
1-{[(2,4-dichlorophenyl)methylidene]amino}-4-(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-amine
1-{[(2,4-dichlorophenyl)methylidene]amino}-4-(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-amine
Compound characteristics
| Compound ID: | K029-0050 |
| Compound Name: | 1-{[(2,4-dichlorophenyl)methylidene]amino}-4-(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-amine |
| Molecular Weight: | 365.28 |
| Molecular Formula: | C16 H14 Cl2 N4 S |
| Smiles: | Cc1cc(c2cn(c(N)n2)/N=C/c2ccc(cc2[Cl])[Cl])c(C)s1 |
| Stereo: | ACHIRAL |
| logP: | 5.2924 |
| logD: | 5.2627 |
| logSw: | -6.1429 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 42.455 |
| InChI Key: | AFLBNERDXYTHNU-UHFFFAOYSA-N |