2-[4-bromo-5-methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide
Chemical Structure Depiction of
2-[4-bromo-5-methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide
2-[4-bromo-5-methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide
Compound characteristics
| Compound ID: | K061-0138 |
| Compound Name: | 2-[4-bromo-5-methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| Molecular Weight: | 430.14 |
| Molecular Formula: | C14 H10 Br F6 N3 O |
| Smiles: | Cc1c(c(C(F)(F)F)nn1CC(Nc1ccccc1C(F)(F)F)=O)[Br] |
| Stereo: | ACHIRAL |
| logP: | 3.5807 |
| logD: | 3.5807 |
| logSw: | -3.8156 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.165 |
| InChI Key: | HBWCVHRWOYOHED-UHFFFAOYSA-N |