4-[(4-fluorophenyl)methylidene]-2-(4-nitrophenyl)-1,3-oxazol-5(4H)-one
Chemical Structure Depiction of
4-[(4-fluorophenyl)methylidene]-2-(4-nitrophenyl)-1,3-oxazol-5(4H)-one
4-[(4-fluorophenyl)methylidene]-2-(4-nitrophenyl)-1,3-oxazol-5(4H)-one
Compound characteristics
| Compound ID: | K074-6577 |
| Compound Name: | 4-[(4-fluorophenyl)methylidene]-2-(4-nitrophenyl)-1,3-oxazol-5(4H)-one |
| Molecular Weight: | 312.25 |
| Molecular Formula: | C16 H9 F N2 O4 |
| Smiles: | C(=C1/C(=O)OC(c2ccc(cc2)[N+]([O-])=O)=N1)/c1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 3.2526 |
| logD: | 3.2526 |
| logSw: | -3.7297 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 63.757 |
| InChI Key: | DDIQNAKAVZNLPT-UHFFFAOYSA-N |