4-[(4-fluorophenyl)methylidene]-2-(4-methylphenyl)-1,3-oxazol-5(4H)-one
Chemical Structure Depiction of
4-[(4-fluorophenyl)methylidene]-2-(4-methylphenyl)-1,3-oxazol-5(4H)-one
4-[(4-fluorophenyl)methylidene]-2-(4-methylphenyl)-1,3-oxazol-5(4H)-one
Compound characteristics
| Compound ID: | K074-7171 |
| Compound Name: | 4-[(4-fluorophenyl)methylidene]-2-(4-methylphenyl)-1,3-oxazol-5(4H)-one |
| Molecular Weight: | 281.28 |
| Molecular Formula: | C17 H12 F N O2 |
| Smiles: | Cc1ccc(cc1)C1=NC(=C/c2ccc(cc2)F)\C(=O)O1 |
| Stereo: | ACHIRAL |
| logP: | 3.7504 |
| logD: | 3.7504 |
| logSw: | -4.0678 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.3756 |
| InChI Key: | AHRXFCKMLBHXIS-UHFFFAOYSA-N |