4-[(2,4-dichlorophenyl)methylidene]-2-(thiophen-2-yl)-1,3-oxazol-5(4H)-one
Chemical Structure Depiction of
4-[(2,4-dichlorophenyl)methylidene]-2-(thiophen-2-yl)-1,3-oxazol-5(4H)-one
4-[(2,4-dichlorophenyl)methylidene]-2-(thiophen-2-yl)-1,3-oxazol-5(4H)-one
Compound characteristics
| Compound ID: | K075-1822 |
| Compound Name: | 4-[(2,4-dichlorophenyl)methylidene]-2-(thiophen-2-yl)-1,3-oxazol-5(4H)-one |
| Molecular Weight: | 324.18 |
| Molecular Formula: | C14 H7 Cl2 N O2 S |
| Smiles: | C(=C1/C(=O)OC(c2cccs2)=N1)\c1ccc(cc1[Cl])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.5254 |
| logD: | 4.5254 |
| logSw: | -4.6614 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.394 |
| InChI Key: | LQNHPVLNYWJLDP-UHFFFAOYSA-N |