2-(2,4-dichlorophenyl)-4-{[4-(trifluoromethoxy)phenyl]methylidene}-1,3-oxazol-5(4H)-one
Chemical Structure Depiction of
2-(2,4-dichlorophenyl)-4-{[4-(trifluoromethoxy)phenyl]methylidene}-1,3-oxazol-5(4H)-one
2-(2,4-dichlorophenyl)-4-{[4-(trifluoromethoxy)phenyl]methylidene}-1,3-oxazol-5(4H)-one
Compound characteristics
| Compound ID: | K075-5746 |
| Compound Name: | 2-(2,4-dichlorophenyl)-4-{[4-(trifluoromethoxy)phenyl]methylidene}-1,3-oxazol-5(4H)-one |
| Molecular Weight: | 402.15 |
| Molecular Formula: | C17 H8 Cl2 F3 N O3 |
| Smiles: | C(=C1/C(=O)OC(c2ccc(cc2[Cl])[Cl])=N1)\c1ccc(cc1)OC(F)(F)F |
| Stereo: | ACHIRAL |
| logP: | 5.6226 |
| logD: | 5.6226 |
| logSw: | -6.1825 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 36.312 |
| InChI Key: | NLZQGYXPKKRIPI-UHFFFAOYSA-N |