2-(4-butylphenyl)-4-[3-(2-methoxyphenyl)prop-2-en-1-ylidene]-1,3-oxazol-5(4H)-one
Chemical Structure Depiction of
2-(4-butylphenyl)-4-[3-(2-methoxyphenyl)prop-2-en-1-ylidene]-1,3-oxazol-5(4H)-one
2-(4-butylphenyl)-4-[3-(2-methoxyphenyl)prop-2-en-1-ylidene]-1,3-oxazol-5(4H)-one
Compound characteristics
| Compound ID: | K088-0020 |
| Compound Name: | 2-(4-butylphenyl)-4-[3-(2-methoxyphenyl)prop-2-en-1-ylidene]-1,3-oxazol-5(4H)-one |
| Molecular Weight: | 361.44 |
| Molecular Formula: | C23 H23 N O3 |
| Smiles: | CCCCc1ccc(cc1)C1=NC(=C/C=C/c2ccccc2OC)\C(=O)O1 |
| Stereo: | ACHIRAL |
| logP: | 5.9983 |
| logD: | 5.9983 |
| logSw: | -5.6025 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 38.006 |
| InChI Key: | RLQZMSQGPBCQDO-UHFFFAOYSA-N |