2-(2-chloro-4-methoxyphenyl)-4-[(2,5-dimethoxyphenyl)methylidene]-1,3-oxazol-5(4H)-one
Chemical Structure Depiction of
2-(2-chloro-4-methoxyphenyl)-4-[(2,5-dimethoxyphenyl)methylidene]-1,3-oxazol-5(4H)-one
2-(2-chloro-4-methoxyphenyl)-4-[(2,5-dimethoxyphenyl)methylidene]-1,3-oxazol-5(4H)-one
Compound characteristics
| Compound ID: | K088-0496 |
| Compound Name: | 2-(2-chloro-4-methoxyphenyl)-4-[(2,5-dimethoxyphenyl)methylidene]-1,3-oxazol-5(4H)-one |
| Molecular Weight: | 373.79 |
| Molecular Formula: | C19 H16 Cl N O5 |
| Smiles: | COc1ccc(c(/C=C2/C(=O)OC(c3ccc(cc3[Cl])OC)=N2)c1)OC |
| Stereo: | ACHIRAL |
| logP: | 4.0609 |
| logD: | 4.0609 |
| logSw: | -4.6988 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 53.094 |
| InChI Key: | TVEWBSGBVAUCFE-UHFFFAOYSA-N |