2-(4-methoxyphenyl)-4-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5(4H)-one
Chemical Structure Depiction of
2-(4-methoxyphenyl)-4-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5(4H)-one
2-(4-methoxyphenyl)-4-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5(4H)-one
Compound characteristics
| Compound ID: | K088-0633 |
| Compound Name: | 2-(4-methoxyphenyl)-4-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5(4H)-one |
| Molecular Weight: | 369.37 |
| Molecular Formula: | C20 H19 N O6 |
| Smiles: | COc1ccc(cc1)C1=NC(=C\c2cc(c(c(c2)OC)OC)OC)\C(=O)O1 |
| Stereo: | ACHIRAL |
| logP: | 3.0293 |
| logD: | 3.0293 |
| logSw: | -3.4062 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 60.897 |
| InChI Key: | DSTNZIWJJOXAMB-UHFFFAOYSA-N |