4-{[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4(5H)-ylidene]methyl}phenyl acetate
Chemical Structure Depiction of
4-{[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4(5H)-ylidene]methyl}phenyl acetate
4-{[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4(5H)-ylidene]methyl}phenyl acetate
Compound characteristics
| Compound ID: | K088-0690 |
| Compound Name: | 4-{[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4(5H)-ylidene]methyl}phenyl acetate |
| Molecular Weight: | 337.33 |
| Molecular Formula: | C19 H15 N O5 |
| Smiles: | CC(=O)Oc1ccc(/C=C2/C(=O)OC(c3ccc(cc3)OC)=N2)cc1 |
| Stereo: | ACHIRAL |
| logP: | 2.7595 |
| logD: | 2.7595 |
| logSw: | -3.1235 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 58.67 |
| InChI Key: | AMJGSJZJNMLQLW-UHFFFAOYSA-N |