7-chloro-2-(chloromethyl)-4H-pyrido[1,2-a]pyrimidin-4-one
Chemical Structure Depiction of
7-chloro-2-(chloromethyl)-4H-pyrido[1,2-a]pyrimidin-4-one
7-chloro-2-(chloromethyl)-4H-pyrido[1,2-a]pyrimidin-4-one
Compound characteristics
| Compound ID: | K093-0001 |
| Compound Name: | 7-chloro-2-(chloromethyl)-4H-pyrido[1,2-a]pyrimidin-4-one |
| Molecular Weight: | 229.06 |
| Molecular Formula: | C9 H6 Cl2 N2 O |
| Smiles: | C(C1=CC(N2C=C(C=CC2=N1)[Cl])=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 1.1157 |
| logD: | 1.1157 |
| logSw: | -2.0966 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 26.7439 |
| InChI Key: | VQYIAJIVEVIZOA-UHFFFAOYSA-N |