3-(3-chloro-4-fluorophenyl)-2-(4-fluorophenyl)-1,3-thiazolidin-4-one
Chemical Structure Depiction of
3-(3-chloro-4-fluorophenyl)-2-(4-fluorophenyl)-1,3-thiazolidin-4-one
3-(3-chloro-4-fluorophenyl)-2-(4-fluorophenyl)-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | K205-0442 |
| Compound Name: | 3-(3-chloro-4-fluorophenyl)-2-(4-fluorophenyl)-1,3-thiazolidin-4-one |
| Molecular Weight: | 325.76 |
| Molecular Formula: | C15 H10 Cl F2 N O S |
| Smiles: | C1C(N(C(c2ccc(cc2)F)S1)c1ccc(c(c1)[Cl])F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.896 |
| logD: | 3.896 |
| logSw: | -4.4322 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 16.1329 |
| InChI Key: | CSWNOJBBOGZOBI-HNNXBMFYSA-N |