3-(3,5-dimethylphenyl)-2-(2-fluorophenyl)-1,3-thiazolidin-4-one
Chemical Structure Depiction of
3-(3,5-dimethylphenyl)-2-(2-fluorophenyl)-1,3-thiazolidin-4-one
3-(3,5-dimethylphenyl)-2-(2-fluorophenyl)-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | K205-0599 |
| Compound Name: | 3-(3,5-dimethylphenyl)-2-(2-fluorophenyl)-1,3-thiazolidin-4-one |
| Molecular Weight: | 301.38 |
| Molecular Formula: | C17 H16 F N O S |
| Smiles: | Cc1cc(C)cc(c1)N1C(c2ccccc2F)SCC1=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.4371 |
| logD: | 4.4371 |
| logSw: | -4.3688 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 16.1329 |
| InChI Key: | CUQWIYWZHFQGHX-KRWDZBQOSA-N |