3-(5-chloro-2-methoxyphenyl)-2-(3-phenoxyphenyl)-1,3-thiazolidin-4-one
Chemical Structure Depiction of
3-(5-chloro-2-methoxyphenyl)-2-(3-phenoxyphenyl)-1,3-thiazolidin-4-one
3-(5-chloro-2-methoxyphenyl)-2-(3-phenoxyphenyl)-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | K205-0961 |
| Compound Name: | 3-(5-chloro-2-methoxyphenyl)-2-(3-phenoxyphenyl)-1,3-thiazolidin-4-one |
| Molecular Weight: | 411.91 |
| Molecular Formula: | C22 H18 Cl N O3 S |
| Smiles: | COc1ccc(cc1N1C(c2cccc(c2)Oc2ccccc2)SCC1=O)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3402 |
| logD: | 5.3402 |
| logSw: | -5.9585 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 30.2102 |
| InChI Key: | VGSQHYRVIUATIT-QFIPXVFZSA-N |