3-(2,4-dimethoxyphenyl)-2-(2-fluorophenyl)-1,3-thiazolidin-4-one
Chemical Structure Depiction of
3-(2,4-dimethoxyphenyl)-2-(2-fluorophenyl)-1,3-thiazolidin-4-one
3-(2,4-dimethoxyphenyl)-2-(2-fluorophenyl)-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | K205-1033 |
| Compound Name: | 3-(2,4-dimethoxyphenyl)-2-(2-fluorophenyl)-1,3-thiazolidin-4-one |
| Molecular Weight: | 333.38 |
| Molecular Formula: | C17 H16 F N O3 S |
| Smiles: | COc1ccc(c(c1)OC)N1C(c2ccccc2F)SCC1=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4934 |
| logD: | 3.4934 |
| logSw: | -3.9107 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 31.0062 |
| InChI Key: | YUSMRHQEQZEORC-KRWDZBQOSA-N |