3-(2-fluorophenyl)-2-[4-(methylsulfanyl)phenyl]-1,3-thiazolidin-4-one
Chemical Structure Depiction of
3-(2-fluorophenyl)-2-[4-(methylsulfanyl)phenyl]-1,3-thiazolidin-4-one
3-(2-fluorophenyl)-2-[4-(methylsulfanyl)phenyl]-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | K205-1581 |
| Compound Name: | 3-(2-fluorophenyl)-2-[4-(methylsulfanyl)phenyl]-1,3-thiazolidin-4-one |
| Molecular Weight: | 319.42 |
| Molecular Formula: | C16 H14 F N O S2 |
| Smiles: | CSc1ccc(cc1)C1N(C(CS1)=O)c1ccccc1F |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9377 |
| logD: | 3.9377 |
| logSw: | -4.0218 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 15.832 |
| InChI Key: | VCXKFPKPYITHAH-INIZCTEOSA-N |