3-(2-chlorophenyl)-5-methyl-N-[4-(phenyldiazenyl)naphthalen-1-yl]-1,2-oxazole-4-carboxamide
Chemical Structure Depiction of
3-(2-chlorophenyl)-5-methyl-N-[4-(phenyldiazenyl)naphthalen-1-yl]-1,2-oxazole-4-carboxamide
3-(2-chlorophenyl)-5-methyl-N-[4-(phenyldiazenyl)naphthalen-1-yl]-1,2-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | K213-0035 |
| Compound Name: | 3-(2-chlorophenyl)-5-methyl-N-[4-(phenyldiazenyl)naphthalen-1-yl]-1,2-oxazole-4-carboxamide |
| Molecular Weight: | 466.93 |
| Molecular Formula: | C27 H19 Cl N4 O2 |
| Smiles: | Cc1c(C(Nc2ccc(c3ccccc23)/N=N/c2ccccc2)=O)c(c2ccccc2[Cl])no1 |
| Stereo: | ACHIRAL |
| logP: | 6.7963 |
| logD: | 6.7946 |
| logSw: | -6.4083 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.31 |
| InChI Key: | XBRGIZAAGJNOGP-UHFFFAOYSA-N |