N-[(4-methylphenyl)methyl]-2,3-bis(3,4,5-trimethoxyphenyl)quinoxaline-6-carboxamide
Chemical Structure Depiction of
N-[(4-methylphenyl)methyl]-2,3-bis(3,4,5-trimethoxyphenyl)quinoxaline-6-carboxamide
N-[(4-methylphenyl)methyl]-2,3-bis(3,4,5-trimethoxyphenyl)quinoxaline-6-carboxamide
Compound characteristics
| Compound ID: | K216-1364 |
| Compound Name: | N-[(4-methylphenyl)methyl]-2,3-bis(3,4,5-trimethoxyphenyl)quinoxaline-6-carboxamide |
| Molecular Weight: | 609.68 |
| Molecular Formula: | C35 H35 N3 O7 |
| Smiles: | Cc1ccc(CNC(c2ccc3c(c2)nc(c2cc(c(c(c2)OC)OC)OC)c(c2cc(c(c(c2)OC)OC)OC)n3)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.3877 |
| logD: | 5.3781 |
| logSw: | -5.3578 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 88.538 |
| InChI Key: | LKOUDVKAJVBPGA-UHFFFAOYSA-N |