2-{[5,6-bis(4-ethoxy-3-methoxyphenyl)-1,2,4-triazin-3-yl]sulfanyl}-N-(2-phenylethyl)acetamide
Chemical Structure Depiction of
2-{[5,6-bis(4-ethoxy-3-methoxyphenyl)-1,2,4-triazin-3-yl]sulfanyl}-N-(2-phenylethyl)acetamide
2-{[5,6-bis(4-ethoxy-3-methoxyphenyl)-1,2,4-triazin-3-yl]sulfanyl}-N-(2-phenylethyl)acetamide
Compound characteristics
| Compound ID: | K216-2935 |
| Compound Name: | 2-{[5,6-bis(4-ethoxy-3-methoxyphenyl)-1,2,4-triazin-3-yl]sulfanyl}-N-(2-phenylethyl)acetamide |
| Molecular Weight: | 574.7 |
| Molecular Formula: | C31 H34 N4 O5 S |
| Smiles: | CCOc1ccc(cc1OC)c1c(c2ccc(c(c2)OC)OCC)nnc(n1)SCC(NCCc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2017 |
| logD: | 4.2017 |
| logSw: | -4.2747 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 85.379 |
| InChI Key: | ZEGRDYIVCWJGLF-UHFFFAOYSA-N |