dimethyl 2-[(2-oxo-2H-1-benzopyran-3-carbonyl)amino]benzene-1,4-dicarboxylate
Chemical Structure Depiction of
dimethyl 2-[(2-oxo-2H-1-benzopyran-3-carbonyl)amino]benzene-1,4-dicarboxylate
dimethyl 2-[(2-oxo-2H-1-benzopyran-3-carbonyl)amino]benzene-1,4-dicarboxylate
Compound characteristics
| Compound ID: | K219-0738 |
| Compound Name: | dimethyl 2-[(2-oxo-2H-1-benzopyran-3-carbonyl)amino]benzene-1,4-dicarboxylate |
| Molecular Weight: | 381.34 |
| Molecular Formula: | C20 H15 N O7 |
| Smiles: | COC(c1ccc(C(=O)OC)c(c1)NC(C1=Cc2ccccc2OC1=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8908 |
| logD: | 0.909 |
| logSw: | -3.615 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 85.901 |
| InChI Key: | UTOUEFUZPLOMCD-UHFFFAOYSA-N |