2-[(3-fluoro-4-methylphenyl)imino]-5-(hydroxymethyl)-8-methyl-N-(4-methylphenyl)-2H-pyrano[2,3-c]pyridine-3-carboxamide
Chemical Structure Depiction of
2-[(3-fluoro-4-methylphenyl)imino]-5-(hydroxymethyl)-8-methyl-N-(4-methylphenyl)-2H-pyrano[2,3-c]pyridine-3-carboxamide
2-[(3-fluoro-4-methylphenyl)imino]-5-(hydroxymethyl)-8-methyl-N-(4-methylphenyl)-2H-pyrano[2,3-c]pyridine-3-carboxamide
Compound characteristics
| Compound ID: | K227-0296 |
| Compound Name: | 2-[(3-fluoro-4-methylphenyl)imino]-5-(hydroxymethyl)-8-methyl-N-(4-methylphenyl)-2H-pyrano[2,3-c]pyridine-3-carboxamide |
| Molecular Weight: | 431.47 |
| Molecular Formula: | C25 H22 F N3 O3 |
| Smiles: | Cc1ccc(cc1)NC(C1=Cc2c(CO)cnc(C)c2OC/1=N/c1ccc(C)c(c1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4186 |
| logD: | 4.4186 |
| logSw: | -4.2674 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.55 |
| InChI Key: | YDPHDRGYKDSCOO-UHFFFAOYSA-N |