{2-[(3,5-dimethoxyphenyl)imino]-8-methyl-3-[(4-methylphenyl)carbamoyl]-2H-pyrano[2,3-c]pyridin-5-yl}methyl acetate
Chemical Structure Depiction of
{2-[(3,5-dimethoxyphenyl)imino]-8-methyl-3-[(4-methylphenyl)carbamoyl]-2H-pyrano[2,3-c]pyridin-5-yl}methyl acetate
{2-[(3,5-dimethoxyphenyl)imino]-8-methyl-3-[(4-methylphenyl)carbamoyl]-2H-pyrano[2,3-c]pyridin-5-yl}methyl acetate
Compound characteristics
| Compound ID: | K227-0338 |
| Compound Name: | {2-[(3,5-dimethoxyphenyl)imino]-8-methyl-3-[(4-methylphenyl)carbamoyl]-2H-pyrano[2,3-c]pyridin-5-yl}methyl acetate |
| Molecular Weight: | 501.54 |
| Molecular Formula: | C28 H27 N3 O6 |
| Smiles: | CC(=O)OCc1cnc(C)c2c1C=C(/C(=N/c1cc(cc(c1)OC)OC)O2)C(Nc1ccc(C)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.556 |
| logD: | 4.5559 |
| logSw: | -4.3538 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 84.753 |
| InChI Key: | LGZYNMTZKKRXBJ-UHFFFAOYSA-N |