N-(2,4-dimethoxyphenyl)-5-(hydroxymethyl)-2-[(2-methoxy-5-methylphenyl)imino]-8-methyl-2H-pyrano[2,3-c]pyridine-3-carboxamide
Chemical Structure Depiction of
N-(2,4-dimethoxyphenyl)-5-(hydroxymethyl)-2-[(2-methoxy-5-methylphenyl)imino]-8-methyl-2H-pyrano[2,3-c]pyridine-3-carboxamide
N-(2,4-dimethoxyphenyl)-5-(hydroxymethyl)-2-[(2-methoxy-5-methylphenyl)imino]-8-methyl-2H-pyrano[2,3-c]pyridine-3-carboxamide
Compound characteristics
| Compound ID: | K227-0650 |
| Compound Name: | N-(2,4-dimethoxyphenyl)-5-(hydroxymethyl)-2-[(2-methoxy-5-methylphenyl)imino]-8-methyl-2H-pyrano[2,3-c]pyridine-3-carboxamide |
| Molecular Weight: | 489.53 |
| Molecular Formula: | C27 H27 N3 O6 |
| Smiles: | Cc1ccc(c(c1)/N=C1/C(=Cc2c(CO)cnc(C)c2O1)C(Nc1ccc(cc1OC)OC)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 3.4398 |
| logD: | 3.4389 |
| logSw: | -3.8115 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 86.959 |
| InChI Key: | ZLXBYXNUBVSTDR-UHFFFAOYSA-N |