2-[(3-bromophenyl)imino]-5-(hydroxymethyl)-N-(2-methoxy-5-methylphenyl)-8-methyl-2H-pyrano[2,3-c]pyridine-3-carboxamide
Chemical Structure Depiction of
2-[(3-bromophenyl)imino]-5-(hydroxymethyl)-N-(2-methoxy-5-methylphenyl)-8-methyl-2H-pyrano[2,3-c]pyridine-3-carboxamide
2-[(3-bromophenyl)imino]-5-(hydroxymethyl)-N-(2-methoxy-5-methylphenyl)-8-methyl-2H-pyrano[2,3-c]pyridine-3-carboxamide
Compound characteristics
| Compound ID: | K227-0744 |
| Compound Name: | 2-[(3-bromophenyl)imino]-5-(hydroxymethyl)-N-(2-methoxy-5-methylphenyl)-8-methyl-2H-pyrano[2,3-c]pyridine-3-carboxamide |
| Molecular Weight: | 508.37 |
| Molecular Formula: | C25 H22 Br N3 O4 |
| Smiles: | Cc1ccc(c(c1)NC(C1=Cc2c(CO)cnc(C)c2OC/1=N/c1cccc(c1)[Br])=O)OC |
| Stereo: | ACHIRAL |
| logP: | 4.1629 |
| logD: | 4.1626 |
| logSw: | -4.3513 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.482 |
| InChI Key: | AZACDSXNOIOGRB-UHFFFAOYSA-N |