{2-[(2,5-dimethoxyphenyl)imino]-3-[(2-methoxy-5-methylphenyl)carbamoyl]-8-methyl-2H-pyrano[2,3-c]pyridin-5-yl}methyl acetate
Chemical Structure Depiction of
{2-[(2,5-dimethoxyphenyl)imino]-3-[(2-methoxy-5-methylphenyl)carbamoyl]-8-methyl-2H-pyrano[2,3-c]pyridin-5-yl}methyl acetate
{2-[(2,5-dimethoxyphenyl)imino]-3-[(2-methoxy-5-methylphenyl)carbamoyl]-8-methyl-2H-pyrano[2,3-c]pyridin-5-yl}methyl acetate
Compound characteristics
| Compound ID: | K227-0789 |
| Compound Name: | {2-[(2,5-dimethoxyphenyl)imino]-3-[(2-methoxy-5-methylphenyl)carbamoyl]-8-methyl-2H-pyrano[2,3-c]pyridin-5-yl}methyl acetate |
| Molecular Weight: | 531.57 |
| Molecular Formula: | C29 H29 N3 O7 |
| Smiles: | CC(=O)OCc1cnc(C)c2c1C=C(/C(=N/c1cc(ccc1OC)OC)O2)C(Nc1cc(C)ccc1OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9491 |
| logD: | 3.9488 |
| logSw: | -4.1832 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 91.075 |
| InChI Key: | MDCOEJRDIIVLKR-UHFFFAOYSA-N |