{3-[(2-chlorophenyl)carbamoyl]-8-methyl-2-(phenylimino)-2H-pyrano[2,3-c]pyridin-5-yl}methyl acetate
Chemical Structure Depiction of
{3-[(2-chlorophenyl)carbamoyl]-8-methyl-2-(phenylimino)-2H-pyrano[2,3-c]pyridin-5-yl}methyl acetate
{3-[(2-chlorophenyl)carbamoyl]-8-methyl-2-(phenylimino)-2H-pyrano[2,3-c]pyridin-5-yl}methyl acetate
Compound characteristics
| Compound ID: | K227-0861 |
| Compound Name: | {3-[(2-chlorophenyl)carbamoyl]-8-methyl-2-(phenylimino)-2H-pyrano[2,3-c]pyridin-5-yl}methyl acetate |
| Molecular Weight: | 461.9 |
| Molecular Formula: | C25 H20 Cl N3 O4 |
| Smiles: | CC(=O)OCc1cnc(C)c2c1C=C(/C(=N/c1ccccc1)O2)C(Nc1ccccc1[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.8433 |
| logD: | 3.8421 |
| logSw: | -4.0932 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.968 |
| InChI Key: | AUJVOLMDKDAKPT-UHFFFAOYSA-N |