8-ethoxy-3-[3-(4-methylphenyl)prop-2-enoyl]-2H-1-benzopyran-2-one
Chemical Structure Depiction of
8-ethoxy-3-[3-(4-methylphenyl)prop-2-enoyl]-2H-1-benzopyran-2-one
8-ethoxy-3-[3-(4-methylphenyl)prop-2-enoyl]-2H-1-benzopyran-2-one
Compound characteristics
| Compound ID: | K229-1000 |
| Compound Name: | 8-ethoxy-3-[3-(4-methylphenyl)prop-2-enoyl]-2H-1-benzopyran-2-one |
| Molecular Weight: | 334.37 |
| Molecular Formula: | C21 H18 O4 |
| Smiles: | CCOc1cccc2C=C(C(/C=C/c3ccc(C)cc3)=O)C(=O)Oc12 |
| Stereo: | ACHIRAL |
| logP: | 4.5202 |
| logD: | 4.5202 |
| logSw: | -4.5435 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 41.03 |
| InChI Key: | AMOQKODGYFUOIT-UHFFFAOYSA-N |