3-[5-(5-fluoro-2-methylanilino)-1,3,4-thiadiazol-2-yl]-6-methoxy-2H-1-benzopyran-2-one
Chemical Structure Depiction of
3-[5-(5-fluoro-2-methylanilino)-1,3,4-thiadiazol-2-yl]-6-methoxy-2H-1-benzopyran-2-one
3-[5-(5-fluoro-2-methylanilino)-1,3,4-thiadiazol-2-yl]-6-methoxy-2H-1-benzopyran-2-one
Compound characteristics
| Compound ID: | K231-0333 |
| Compound Name: | 3-[5-(5-fluoro-2-methylanilino)-1,3,4-thiadiazol-2-yl]-6-methoxy-2H-1-benzopyran-2-one |
| Molecular Weight: | 383.4 |
| Molecular Formula: | C19 H14 F N3 O3 S |
| Smiles: | Cc1ccc(cc1Nc1nnc(C2=Cc3cc(ccc3OC2=O)OC)s1)F |
| Stereo: | ACHIRAL |
| logP: | 4.3443 |
| logD: | 4.3443 |
| logSw: | -4.4663 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.192 |
| InChI Key: | XGSXESLORISKIH-UHFFFAOYSA-N |