1-(4-chlorophenyl)-4-(4-ethylphenyl)-1,3-dihydro-2H-imidazole-2-thione
Chemical Structure Depiction of
1-(4-chlorophenyl)-4-(4-ethylphenyl)-1,3-dihydro-2H-imidazole-2-thione
1-(4-chlorophenyl)-4-(4-ethylphenyl)-1,3-dihydro-2H-imidazole-2-thione
Compound characteristics
| Compound ID: | K241-0085 |
| Compound Name: | 1-(4-chlorophenyl)-4-(4-ethylphenyl)-1,3-dihydro-2H-imidazole-2-thione |
| Molecular Weight: | 314.83 |
| Molecular Formula: | C17 H15 Cl N2 S |
| Smiles: | CCc1ccc(cc1)C1=CN(C(N1)=S)c1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.0609 |
| logD: | 3.3204 |
| logSw: | -5.3484 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 14.3983 |
| InChI Key: | VBICWWSYCUKFQN-UHFFFAOYSA-N |