4-(2H-1,3-benzodioxol-5-yl)-1-(3-chlorophenyl)-1,3-dihydro-2H-imidazole-2-thione
Chemical Structure Depiction of
4-(2H-1,3-benzodioxol-5-yl)-1-(3-chlorophenyl)-1,3-dihydro-2H-imidazole-2-thione
4-(2H-1,3-benzodioxol-5-yl)-1-(3-chlorophenyl)-1,3-dihydro-2H-imidazole-2-thione
Compound characteristics
| Compound ID: | K241-0300 |
| Compound Name: | 4-(2H-1,3-benzodioxol-5-yl)-1-(3-chlorophenyl)-1,3-dihydro-2H-imidazole-2-thione |
| Molecular Weight: | 330.79 |
| Molecular Formula: | C16 H11 Cl N2 O2 S |
| Smiles: | C1Oc2ccc(cc2O1)C1=CN(C(N1)=S)c1cccc(c1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.0868 |
| logD: | 2.4175 |
| logSw: | -4.4909 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 31.5137 |
| InChI Key: | WENIXJCNRTZVTC-UHFFFAOYSA-N |