2-{[1-(4-methoxyphenyl)-4-phenyl-1H-imidazol-2-yl]sulfanyl}-N-(2-methylphenyl)acetamide
Chemical Structure Depiction of
2-{[1-(4-methoxyphenyl)-4-phenyl-1H-imidazol-2-yl]sulfanyl}-N-(2-methylphenyl)acetamide
2-{[1-(4-methoxyphenyl)-4-phenyl-1H-imidazol-2-yl]sulfanyl}-N-(2-methylphenyl)acetamide
Compound characteristics
| Compound ID: | K242-0033 |
| Compound Name: | 2-{[1-(4-methoxyphenyl)-4-phenyl-1H-imidazol-2-yl]sulfanyl}-N-(2-methylphenyl)acetamide |
| Molecular Weight: | 429.54 |
| Molecular Formula: | C25 H23 N3 O2 S |
| Smiles: | Cc1ccccc1NC(CSc1nc(cn1c1ccc(cc1)OC)c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3817 |
| logD: | 5.3816 |
| logSw: | -5.315 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.702 |
| InChI Key: | IPBZOEDCJMOCHP-UHFFFAOYSA-N |